2,3,4,5,6-Pentafluor-D-phenylalanin structure
|
Common Name | 2,3,4,5,6-Pentafluor-D-phenylalanin | ||
|---|---|---|---|---|
| CAS Number | 3321-96-8 | Molecular Weight | 255.141 | |
| Density | 1.609g/cm3 | Boiling Point | 286.3±40.0 °C at 760 mmHg | |
| Molecular Formula | C9H6F5NO2 | Melting Point | 254-258ºC | |
| MSDS | N/A | Flash Point | 126.9±27.3 °C | |
| Name | 2-amino-3-(2,3,4,5,6-pentafluorophenyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.609g/cm3 |
|---|---|
| Boiling Point | 286.3±40.0 °C at 760 mmHg |
| Melting Point | 254-258ºC |
| Molecular Formula | C9H6F5NO2 |
| Molecular Weight | 255.141 |
| Flash Point | 126.9±27.3 °C |
| Exact Mass | 255.031876 |
| PSA | 63.32000 |
| LogP | 1.30 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| InChIKey | YYTDJPUFAVPHQA-UHFFFAOYSA-N |
| SMILES | NC(Cc1c(F)c(F)c(F)c(F)c1F)C(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922499990 |
|
~%
2,3,4,5,6-Penta... CAS#:3321-96-8 |
| Literature: Filler,R. et al. Journal of Organic Chemistry, 1969 , vol. 34, # 3 p. 534 - 538 |
|
~%
2,3,4,5,6-Penta... CAS#:3321-96-8 |
| Literature: Filler,R. et al. Journal of Organic Chemistry, 1969 , vol. 34, # 3 p. 534 - 538 |
|
~%
2,3,4,5,6-Penta... CAS#:3321-96-8 |
| Literature: Filler,R. et al. Journal of Organic Chemistry, 1969 , vol. 34, # 3 p. 534 - 538 |
|
~%
2,3,4,5,6-Penta... CAS#:3321-96-8 |
| Literature: Beguin, Claude; Hamman, Sylvain Organic Magnetic Resonance, 1981 , vol. 16, # 2 p. 129 - 132 |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2,3,4,5,6-PENTAFLUORO-DL-PHENYLALANINE |
| (+-)-2-Amino-3-<pentafluor-phenyl>-propionsaeure |
| DL-Pentafluorophenylalanine |
| 2-Amino-3-(2,3,4,5,6-pentafluorphenyl)propionsaeure |
| Pentafluor-phenylalanin |
| D-phenylalanine, 2,3,4,5,6-pentafluoro- |
| (R,S)-pentafluoropenylalanine |
| 2,3,4,5,6-pentafluoro-phenylalanine |
| 2,3,4,5,6-PENTAFLUORO-D,L-PHENYLANALINE |
| (2R)-2-Ammonio-3-(pentafluorophenyl)propanoate |
| 2-AMINO-3-PENTAFLUOROPHENYL-PROPIONIC ACID |
| 3-(Pentafluorophenyl)-DL-alanine |
| (Pentafluorophenyl) alanine |
| Benzeneethanaminium, α-carboxy-2,3,4,5,6-pentafluoro-, inner salt, (αR)- |
| 2,3,4,5,6-Pentafluoro-D-phenylalanine |
| rac.-(2,3,4,5,6-Pentafluorphenyl)-alanin |
| 2,3,4,5,6-Pentafluor-D-phenylalanin |