3-(3,4-dimethoxyphenyl)-3-methyl-butanoic acid structure
|
Common Name | 3-(3,4-dimethoxyphenyl)-3-methyl-butanoic acid | ||
|---|---|---|---|---|
| CAS Number | 33214-44-7 | Molecular Weight | 238.28000 | |
| Density | 1.106g/cm3 | Boiling Point | 357.2ºC at 760 mmHg | |
| Molecular Formula | C13H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 130.3ºC | |
| Name | 3-(3,4-dimethoxyphenyl)-3-methylbutanoic acid |
|---|
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 357.2ºC at 760 mmHg |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28000 |
| Flash Point | 130.3ºC |
| Exact Mass | 238.12100 |
| PSA | 55.76000 |
| LogP | 2.45610 |
| Index of Refraction | 1.508 |
| InChIKey | KMPOKKWQNFUVKL-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(C)(C)CC(=O)O)cc1OC |
|
~%
3-(3,4-dimethox... CAS#:33214-44-7 |
| Literature: Winstein,S.; Heck,R.F. Journal of Organic Chemistry, 1972 , vol. 37, p. 825 - 836 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |