methyl 2-bromo-3-(3,4-dimethoxyphenyl)-3-hydroxy-propanoate structure
|
Common Name | methyl 2-bromo-3-(3,4-dimethoxyphenyl)-3-hydroxy-propanoate | ||
|---|---|---|---|---|
| CAS Number | 5396-67-8 | Molecular Weight | 319.14900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BrO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Hydracrylic acid, 2-bromo-3-(3,4-dimethoxyphenyl)-, methyl ester |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15BrO5 |
|---|---|
| Molecular Weight | 319.14900 |
| Exact Mass | 318.01000 |
| PSA | 64.99000 |
| LogP | 1.67370 |
| InChIKey | RYYMZWXGKKBRNJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(Br)C(O)c1ccc(OC)c(OC)c1 |
| HS Code | 2918990090 |
|---|
|
~%
methyl 2-bromo-... CAS#:5396-67-8 |
| Literature: Reimer; Tobin; Schaffner Journal of the American Chemical Society, 1935 , vol. 57, p. 211,214 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,4-Naphthalenedione,2-bromo-3-[(2-hydroxyethyl)amino] |
| Opt.-inakt. 2-Brom-3-hydroxy-3-(3.4-dimethoxy-phenyl)-propionsaeure-methylester |
| 1,4-Naphthoquinone,2-bromo-3-[(2-hydroxyethyl)amino]-(7CI) |
| 2-Brom-3-(3,4-dimethoxy-phenyl)-3-hydroxy-propionsaeure-methylester |
| 2-bromo-3-(3,4-dimethoxy-phenyl)-3-hydroxy-propionic acid methyl ester |
| 2-Bromo-3-(2-hydroxyethylamino)-1,4-naphthoquinone |