7,7-dichloro-2,5-diphenylbicyclo[4.1.0]hepta-1,3,5-triene structure
|
Common Name | 7,7-dichloro-2,5-diphenylbicyclo[4.1.0]hepta-1,3,5-triene | ||
|---|---|---|---|---|
| CAS Number | 33253-76-8 | Molecular Weight | 311.20500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H12Cl2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 7,7-dichloro-2,5-diphenylbicyclo[4.1.0]hepta-1,3,5-triene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C19H12Cl2 |
|---|---|
| Molecular Weight | 311.20500 |
| Exact Mass | 310.03200 |
| LogP | 6.01270 |
| InChIKey | RRTJNELVHWCNGY-UHFFFAOYSA-N |
| SMILES | ClC1(Cl)c2c(-c3ccccc3)ccc(-c3ccccc3)c21 |
|
~%
7,7-dichloro-2,... CAS#:33253-76-8 |
| Literature: Halton,B. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 731 - 735 |
|
~%
7,7-dichloro-2,... CAS#:33253-76-8 |
| Literature: Halton,B. et al. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1977 , p. 731 - 735 |
| 1,1-dichloro-2,5-diphenylcyclopropabenzene |
| 1,1-Dichloro-2,5-diphenylcyclopropabenzen |
| 1,1-Dichlor-2,5-diphenylcyclopropabenzol |
| 7,7-Dichlor-2,5-diphenylbenzocyclopropen |
| 7,7-Dichlor-2,5-diphenyl-bicyclo<4.1.0>hepta-1,3,5-trien |
| Benzocyclopropeniumion |