N-desethylaconitine
N-desethylaconitine structure
|
Common Name | N-desethylaconitine | ||
|---|---|---|---|---|
| CAS Number | 3327-35-3 | Molecular Weight | 617.68400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H43NO11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: N-Desethylaconitine, Chinese name N-去乙酰新乌头碱, CAS number 3327-35-3, molecular formula C32H43NO11, molecular weight 617.68400. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-desethylaconitine |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C32H43NO11 |
|---|---|
| Molecular Weight | 617.68400 |
| Exact Mass | 617.28400 |
| PSA | 162.24000 |
| LogP | 0.24460 |
| InChIKey | GYVGYFIPTOWNRV-FYJPCIAISA-N |
| SMILES | COCC12CNC3C4C(OC)C1C3(C(OC)CC2O)C1CC2(O)C(OC)C(O)C4(OC(C)=O)C1C2OC(=O)c1ccccc1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:6900-87-4
CAS#:2752-64-9
CAS#:121236-31-5This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| N-deethylaconitine |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of N-desethylaconitine? |
| A: LogP of N-desethylaconitine is 0.24460. |
| Q: What is the InChIKey of N-desethylaconitine? |
| A: InChIKey of N-desethylaconitine is GYVGYFIPTOWNRV-FYJPCIAISA-N. |
| Q: What is the English name of N-desethylaconitine? |
| A: The English name of N-desethylaconitine is N-desethylaconitine. |
| Q: What is the molecular weight of N-desethylaconitine? |
| A: Molecular weight of N-desethylaconitine is 617.68400. |
| Q: What is the Chinese name of 3327-35-3? |
| A: Chinese name of 3327-35-3 is 3327-35-3. |
| Q: What is the SMILES notation of N-desethylaconitine? |
| A: SMILES notation of N-desethylaconitine is COCC12CNC3C4C(OC)C1C3(C(OC)CC2O)C1CC2(O)C(OC)C(O)C4(OC(C)=O)C1C2OC(=O)c1ccccc1. |
| Q: What is the polar surface area (PSA) of N-desethylaconitine? |
| A: Polar surface area (PSA) of N-desethylaconitine is 162.24000. |
| Q: What English synonyms does N-desethylaconitine have? |
| A: English synonyms of N-desethylaconitine: N-deethylaconitine. |
| Q: What is the CAS number of N-desethylaconitine? |
| A: CAS number of N-desethylaconitine is 3327-35-3. |
| Q: What is the molecular formula of N-desethylaconitine? |
| A: Molecular formula of N-desethylaconitine is C32H43NO11. |