WAY-312208 structure
|
Common Name | WAY-312208 | ||
|---|---|---|---|---|
| CAS Number | 332938-24-6 | Molecular Weight | 371.43 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-312208altering the lifespan of a eukaryotic organism |
| Name | WAY-312208 |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H21NO3 |
|---|---|
| Molecular Weight | 371.43 |
| InChIKey | YWRZMZQUHGUGGB-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)C2=C(C1)NC1=C(C(=O)c3ccccc31)C2c1ccc(O)cc1 |
| 5H-Indeno[1,2-b]quinoline-9,11-dione, 6,7,8,10-tetrahydro-10-(4-hydroxyphenyl)-7,7-dimethyl- |