Heptafluoropropyl-1,2,2,2-tetrafluoroethyl ether structure
|
Common Name | Heptafluoropropyl-1,2,2,2-tetrafluoroethyl ether | ||
|---|---|---|---|---|
| CAS Number | 3330-15-2 | Molecular Weight | 286.04300 | |
| Density | 1.538 | Boiling Point | 40 °C | |
| Molecular Formula | C5HF11O | Melting Point | 8-9°C | |
| MSDS | N/A | Flash Point | 26-36/37/39 | |
| Name | Heptafluoropropyl 1,2,2,2-tetrafluoroethyl ether |
|---|---|
| Synonym | More Synonyms |
| Density | 1.538 |
|---|---|
| Boiling Point | 40 °C |
| Melting Point | 8-9°C |
| Molecular Formula | C5HF11O |
| Molecular Weight | 286.04300 |
| Flash Point | 26-36/37/39 |
| Exact Mass | 285.98500 |
| PSA | 9.23000 |
| LogP | 3.65130 |
| Index of Refraction | 1.2434 |
| InChIKey | CUTPKDUMZWIJKT-UHFFFAOYSA-N |
| SMILES | FC(OC(F)(F)C(F)(F)C(F)(F)F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| RIDADR | 3265 |
| HS Code | 2909199090 |
|
~%
Heptafluoroprop... CAS#:3330-15-2 |
| Literature: Journal of Fluorine Chemistry, , vol. 21, p. 54 |
|
~%
Heptafluoroprop... CAS#:3330-15-2 |
| Literature: Russian Journal of Organic Chemistry, , vol. 31, # 8 p. 1037 - 1039 Zhurnal Organicheskoi Khimii, , vol. 31, # 8 p. 1142 - 1144 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2909199090 |
|---|---|
| Summary | 2909199090. other acyclic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| MFCD00042308 |
| 1,1,1,2,2,3,3-heptafluoro-3-(1,2,2,2-tetrafluoroethoxy)propane |