4-(Cyclohexylamino)-3-nitrobenzoic acid structure
|
Common Name | 4-(Cyclohexylamino)-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 333340-82-2 | Molecular Weight | 264.27700 | |
| Density | 1.349g/cm3 | Boiling Point | 460.9ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 232.5ºC | |
| Name | 4-(Cyclohexylamino)-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.349g/cm3 |
|---|---|
| Boiling Point | 460.9ºC at 760 mmHg |
| Molecular Formula | C13H16N2O4 |
| Molecular Weight | 264.27700 |
| Flash Point | 232.5ºC |
| Exact Mass | 264.11100 |
| PSA | 95.15000 |
| LogP | 3.63380 |
| Index of Refraction | 1.638 |
| InChIKey | FURGMJHUORLUHU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(NC2CCCCC2)c([N+](=O)[O-])c1 |
| HS Code | 2922499990 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 4-cyclohexylamino-3-nitro-benzoic acid |