WAY-339696 structure
|
Common Name | WAY-339696 | ||
|---|---|---|---|---|
| CAS Number | 333419-97-9 | Molecular Weight | 359.17414 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 526.5±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H11BrN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.2±30.1 °C | |
Use of WAY-339696inhibitors for EGFR-T790M/L858R |
| Name | WAY-339696 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 526.5±50.0 °C at 760 mmHg |
| Molecular Formula | C16H11BrN2O3 |
| Molecular Weight | 359.17414 |
| Flash Point | 272.2±30.1 °C |
| Exact Mass | 357.995300 |
| LogP | 3.82 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.739 |
| InChIKey | UCCUKBQMSKZUOG-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(Br)c1)c1c(O)c2ccccc2[nH]c1=O |
| N-(3-bromophenyl)-4-hydroxy-2-oxo-1,2-dihydroquinoline-3-carboxamide |
| N-(3-Bromophenyl)-2-hydroxy-4-oxo-1,4-dihydro-3-quinolinecarboxamide |
| 3-Quinolinecarboxamide, N-(3-bromophenyl)-1,4-dihydro-2-hydroxy-4-oxo- |
| MFCD02164105 |