5-(4-nitrophenyl)furfuryl alcohol
Modify Date: 2025-08-23 11:47:48
5-(4-nitrophenyl)furfuryl alcohol structure
|
Common Name | 5-(4-nitrophenyl)furfuryl alcohol | ||
|---|---|---|---|---|
| CAS Number | 33342-30-2 | Molecular Weight | 219.19300 | |
| Density | 1.343g/cm3 | Boiling Point | 384.8ºC at 760 mmHg | |
| Molecular Formula | C11H9NO4 | Melting Point | 134-138 °C(lit.) | |
| MSDS | N/A | Flash Point | 186.5ºC | |
| Name | [5-(4-nitrophenyl)furan-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 384.8ºC at 760 mmHg |
| Melting Point | 134-138 °C(lit.) |
| Molecular Formula | C11H9NO4 |
| Molecular Weight | 219.19300 |
| Flash Point | 186.5ºC |
| Exact Mass | 219.05300 |
| PSA | 79.19000 |
| LogP | 2.87030 |
| Index of Refraction | 1.604 |
| InChIKey | SRCRGLMTENDDRR-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(-c2ccc(CO)o2)cc1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2932190090 |
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
Total 3, Current Page 1 of 1
1
| 5-(4-nitrophenyl)-2-furylmethanol |
| 5-(4-nitrophenyl)furfuryl alcohol |
| [5-(4-Nitro-phenyl)-furan-2-yl]-methanol |
| 5-(4-Nitrophenyl)-2-furanmethanol |
| 2-Hydroxymethyl-5-(4-nitrophenyl)-furan |
| [5-(4-nitrophenyl)-2-furyl]methan-1-ol |
| 5-(p-Nitrophenyl)furfuryl alcohol |
| MFCD00239351 |