ethyl 3-carboxy-1,4-dimethyl-1H-pyrrole-2-acetate structure
|
Common Name | ethyl 3-carboxy-1,4-dimethyl-1H-pyrrole-2-acetate | ||
|---|---|---|---|---|
| CAS Number | 33369-46-9 | Molecular Weight | 225.24100 | |
| Density | 1.19g/cm3 | Boiling Point | 360.8ºC at 760mmHg | |
| Molecular Formula | C11H15NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172ºC | |
| Name | 2-(2-ethoxy-2-oxoethyl)-1,4-dimethylpyrrole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 360.8ºC at 760mmHg |
| Molecular Formula | C11H15NO4 |
| Molecular Weight | 225.24100 |
| Flash Point | 172ºC |
| Exact Mass | 225.10000 |
| PSA | 68.53000 |
| LogP | 1.13730 |
| Index of Refraction | 1.53 |
| InChIKey | YVNJDVHARWCERO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1c(C(=O)O)c(C)cn1C |
| HS Code | 2933990090 |
|---|
|
~%
ethyl 3-carboxy... CAS#:33369-46-9 |
| Literature: Cell Pathways Inc Patent: US5939417 A1, 1999 ; |
|
~%
Detail
|
| Literature: Stahly, G. P.; Marlett, E. M.; Nelson, G. E. Journal of Organic Chemistry, 1983 , vol. 48, # 23 p. 4423 - 4426 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-ethoxycarbonylmethyl-1,4-dimethyl-pyrrole-3-carboxylic acid |
| Ethyl 3-carboxy-1,4-dimethyl-1H-pyrrole-2-acetate |
| ethyl 3-carboxy-1,4-dimethylpyrrole-2-acetate |
| EINECS 251-477-9 |
| Ethyl-3-carboxy-1,4-dimethylpyrrol-2-acetat |