Asulam structure
|
Common Name | Asulam | ||
|---|---|---|---|---|
| CAS Number | 3337-71-1 | Molecular Weight | 230.24100 | |
| Density | 1.418g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O4S | Melting Point | 142-144ºC (dec.) | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of AsulamAsulam is a wild oat herbicide used in prairie regions for control of wild oats in cereal grains such as wheat. |
| Name | asulam |
|---|---|
| Synonym | More Synonyms |
| Density | 1.418g/cm3 |
|---|---|
| Melting Point | 142-144ºC (dec.) |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.24100 |
| Exact Mass | 230.03600 |
| PSA | 106.87000 |
| LogP | 2.36640 |
| Index of Refraction | 1.5690 (estimate) |
| InChIKey | VGPYEHKOIGNJKV-UHFFFAOYSA-N |
| SMILES | COC(=O)NS(=O)(=O)c1ccc(N)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22 |
| RIDADR | NONH for all modes of transport |
| RTECS | FD1190000 |
| HS Code | 2935009016 |
|
~%
Asulam CAS#:3337-71-1 |
| Literature: CH222077 , ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2935009016 |
|---|---|
| Summary | 2935009016 methyl (4-aminophenyl)sulfonylcarbamate。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:35.0% |
|
Combined theoretical and experimental study of the photophysics of asulam.
J. Phys. Chem. A 117(10) , 2125-37, (2013) The photophysics of the neutral molecular form of the herbicide asulam has been described in a joint experimental and theoretical, at the CASPT2 level, study. The unique π → π* aromatic electronic tra... |
|
|
Soil photolysis of herbicides in a moisture- and temperature-controlled environment.
J. Agric. Food Chem. 51(15) , 4331-7, (2003) The problem of maintaining the moisture content of samples throughout the course of a soil photolysis study is addressed. The photolytic degradations of asulam, triclopyr, acifluorfen, and atrazine we... |
|
|
Effects of asulam on some microbial activities of three soils.
Bull. Environ. Contam. Toxicol. 25(1) , 15-22, (1980)
|
| methyl N-(4-aminobenzenesulfonyl)carbamate |
| Jonnix |
| Methyl sulphanilylcarbamate |
| Asulox |
| Plakin |
| methyl N-(4-aminophenyl)sulfonylcarbamate |
| Methyl N-(4-aminophenylsulfonyl)carbamate |
| MFCD00055534 |
| N-(methoxycarbonyl)-4-(amino)benzenesulfonamide |
| ASULAM |
| Asilan |
| EINECS 222-077-1 |
| Asulox 40 |
| methyl sulfanilylcarbamate |
| methyl 4-aminophenylsulphonylcarbamate |
| Asulame [ISO-French] |
| methyl (4-aminobenzenesulfonyl)carbamate |
| Asulox F |
| methyl N-[(4-aminophenyl)sulfonyl]carbamate |