WAY-311571 structure
|
Common Name | WAY-311571 | ||
|---|---|---|---|---|
| CAS Number | 333739-88-1 | Molecular Weight | 405.47 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H19N3O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-311571inhibitors of the Hedgehog protein signalling pathway; inhibitors of the Hedgehog protein signalling pathway. |
| Name | WAY-311571 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C22H19N3O3S |
| Molecular Weight | 405.47 |
| Exact Mass | 405.114716 |
| LogP | 3.93 |
| Index of Refraction | 1.708 |
| InChIKey | LRYZQFMVNVJALG-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)NC(=S)Nc2cccc(NC(=O)c3ccccc3)c2)cc1 |
| N-[3-({[(4-methoxybenzoyl)amino]carbothioyl}amino)phenyl]benzamide |
| Benzamide, N-[[[3-(benzoylamino)phenyl]amino]thioxomethyl]-4-methoxy- |
| N-{[3-(Benzoylamino)phenyl]carbamothioyl}-4-methoxybenzamide |