4-(4-PHENYLSULFANYL-PHENYL)-THIAZOL-2-YLAMINE structure
|
Common Name | 4-(4-PHENYLSULFANYL-PHENYL)-THIAZOL-2-YLAMINE | ||
|---|---|---|---|---|
| CAS Number | 333773-69-6 | Molecular Weight | 284.39900 | |
| Density | 1.35g/cm3 | Boiling Point | 508.8ºC at 760mmHg | |
| Molecular Formula | C15H12N2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.5ºC | |
| Name | 4-(4-Phenylsulfanylphenyl)-thiazol-2-ylamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.35g/cm3 |
|---|---|
| Boiling Point | 508.8ºC at 760mmHg |
| Molecular Formula | C15H12N2S2 |
| Molecular Weight | 284.39900 |
| Flash Point | 261.5ºC |
| Exact Mass | 284.04400 |
| PSA | 92.45000 |
| LogP | 5.12470 |
| Index of Refraction | 1.727 |
| InChIKey | UDSGAGSEDJVKAD-UHFFFAOYSA-N |
| SMILES | Nc1nc(-c2ccc(Sc3ccccc3)cc2)cs1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
|
~%
4-(4-PHENYLSULF... CAS#:333773-69-6 |
| Literature: Hargrave, Karl D.; Hess, Friedrich K.; Oliver, James T. Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1158 - 1163 |
|
~51%
4-(4-PHENYLSULF... CAS#:333773-69-6 |
| Literature: Abdel-Hafez Phosphorus, Sulfur and Silicon and the Related Elements, 2003 , vol. 178, # 12 p. 2563 - 2579 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 4-(4-phenylsulfanylphenyl)-1,3-thiazol-2-amine |