9-O-Methyl-4-hydroxyboeravinone B
Modify Date: 2025-08-27 18:26:18
9-O-Methyl-4-hydroxyboeravinone B structure
|
Common Name | 9-O-Methyl-4-hydroxyboeravinone B | ||
|---|---|---|---|---|
| CAS Number | 333798-10-0 | Molecular Weight | 342.300 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 672.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C18H14O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.8±25.0 °C | |
| Name | 9-O-Methyl-4-hydroxyboeravinone B |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 672.9±55.0 °C at 760 mmHg |
| Molecular Formula | C18H14O7 |
| Molecular Weight | 342.300 |
| Flash Point | 251.8±25.0 °C |
| Exact Mass | 342.073944 |
| PSA | 109.36000 |
| LogP | 3.43 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.740 |
| InChIKey | HTLOGFXLFFWJOX-UHFFFAOYSA-N |
| SMILES | COc1cc2oc3c(c(=O)c2c(O)c1C)-c1cccc(O)c1OC3O |
| Hazard Codes | Xi |
|---|
|
Name: Inhibition of BCRP expressed in human HEK293 cells assessed as maximal mitoxantrone a...
Source: ChEMBL
Target: Broad substrate specificity ATP-binding cassette transporter ABCG2
External Id: CHEMBL919517
|
|
Name: Antifungal activity against wild type Candida albicans SC5314 after 24 hrs by XTT ass...
Source: ChEMBL
Target: Candida albicans
External Id: CHEMBL950690
|
|
Name: Antifungal activity against MDR knockout Candida albicans DSY1024 after 24 hrs by XTT...
Source: ChEMBL
Target: Candida albicans
External Id: CHEMBL950689
|
|
Name: Antispasmodic activity in guinea pig ileum assessed as inhibition of acetylcholine-in...
Source: ChEMBL
Target: Ileum
External Id: CHEMBL978338
|
Total 4, Current Page 1 of 1
1
| 4,6,11-Trihydroxy-9-methoxy-10-methylchromeno[2,3-c]chromen-12-one |
| 4,6,11-Trihydroxy-9-methoxy-10-methylchromeno[3,4-b]chromen-12(6H)-one |