2-Amino-3-nitro-6-(4-fluorobenzylamino)pyridine structure
|
Common Name | 2-Amino-3-nitro-6-(4-fluorobenzylamino)pyridine | ||
|---|---|---|---|---|
| CAS Number | 33400-49-6 | Molecular Weight | 262.240 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 464.5±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H11FN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 234.7±28.7 °C | |
| Name | 6-N-[(4-fluorophenyl)methyl]-3-nitropyridine-2,6-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 464.5±45.0 °C at 760 mmHg |
| Molecular Formula | C12H11FN4O2 |
| Molecular Weight | 262.240 |
| Flash Point | 234.7±28.7 °C |
| Exact Mass | 262.086609 |
| PSA | 96.76000 |
| LogP | 3.16 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.690 |
| InChIKey | ZVCIIRBNNSUNCH-UHFFFAOYSA-N |
| SMILES | Nc1nc(NCc2ccc(F)cc2)ccc1[N+](=O)[O-] |
| HS Code | 2933399090 |
|---|
|
~98%
2-Amino-3-nitro... CAS#:33400-49-6 |
| Literature: Csuk, Rene; Sommerwerk, Sven; Wiese, Jana; Wagner, Christoph; Siewert, Bianka; Kluge, Ralph; Stroehl, Dieter Zeitschrift fur Naturforschung - Section B Journal of Chemical Sciences, 2012 , vol. 67, # 12 p. 1297 - 1304 |
|
~%
2-Amino-3-nitro... CAS#:33400-49-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 37, # 19 p. 3016 - 3022 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 251-498-3 |
| 2-Amino-6-(4-fluorobenzylamino)-3-nitropyridine |
| N-(4-Fluorobenzyl)-3-nitro-2,6-pyridinediamine |
| 2,6-Pyridinediamine, N-[(4-fluorophenyl)methyl]-3-nitro- |
| 2-AMINO-6-[(4-FLUOROBENZYL)-AMINO]-3-NITROPYRIDINE |
| 2-Amino-3-nitro-6-(4-fluorobenzylamino)pyridine |
| 2-Amino-3-nitro-6-(4-fluor-benzyl-amino)-pyridin |
| N2-(4-Fluorobenzyl)-5-nitropyridine-2,6-diamine |
| N(6)-(4-FLUOROBENZYL)-3-NITRO-2,6-PYRIDINEDIAMINE |
| N-(4-Fluorobenzyl)-3-nitropyridine-2,6-diamine |
| 2-amino-3-nitro-6-(p-fluoro-benzylamino)-pyridine |
| 4-Methyl-pyrimidin-5-ylamine |
| N6-((4-Fluorophenyl)methyl)-3-nitropyridine-2,6-diamine |