2-(butylamino)-1-(3,4-dihydroxyphenyl)ethanone structure
|
Common Name | 2-(butylamino)-1-(3,4-dihydroxyphenyl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 33406-44-9 | Molecular Weight | 223.26800 | |
| Density | 1.158g/cm3 | Boiling Point | 426ºC at 760 mmHg | |
| Molecular Formula | C12H17NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 211.4ºC | |
| Name | 2-(butylamino)-1-(3,4-dihydroxyphenyl)ethanone |
|---|
| Density | 1.158g/cm3 |
|---|---|
| Boiling Point | 426ºC at 760 mmHg |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.26800 |
| Flash Point | 211.4ºC |
| Exact Mass | 223.12100 |
| PSA | 69.56000 |
| LogP | 2.06110 |
| Index of Refraction | 1.558 |
| InChIKey | LSBYTACKGLHMBM-UHFFFAOYSA-N |
| SMILES | CCCCNCC(=O)c1ccc(O)c(O)c1 |
| HS Code | 2922509090 |
|---|
|
~%
2-(butylamino)-... CAS#:33406-44-9 |
| Literature: Corrigan; Langermann; Moore Journal of the American Chemical Society, 1949 , vol. 71, p. 530 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |