Vestipitant structure
|
Common Name | Vestipitant | ||
|---|---|---|---|---|
| CAS Number | 334476-46-9 | Molecular Weight | 491.44500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H24F7N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of VestipitantVestipitant (GW597599) is a potent, selective, orally active NK1 receptor antagonist with pKi of 9.65. |
| Name | [3H]-Vestipitant |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H24F7N3O |
|---|---|
| Molecular Weight | 491.44500 |
| Exact Mass | 491.18100 |
| PSA | 35.58000 |
| LogP | 6.19770 |
| InChIKey | SBBYBXSFWOLDDG-JLTOFOAXSA-N |
| SMILES | Cc1cc(F)ccc1C1CNCCN1C(=O)N(C)C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Vestipitant |