Vestipitant mesylate structure
|
Common Name | Vestipitant mesylate | ||
|---|---|---|---|---|
| CAS Number | 334476-64-1 | Molecular Weight | 587.55100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H28F7N3O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Vestipitant mesylateVestipitant (GW597599) is a potent, selective, orally active NK1 receptor antagonist with pKi of 9.65. |
| Name | (2S)-N-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethyl]-2-(4-fluoro-2-methylphenyl)-N-methylpiperazine-1-carboxamide,methanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H28F7N3O4S |
|---|---|
| Molecular Weight | 587.55100 |
| Exact Mass | 587.16900 |
| PSA | 98.33000 |
| LogP | 6.78250 |
| InChIKey | BHECXGHXWKHZOY-DXPOFMJKSA-N |
| SMILES | CS(=O)(=O)O.Cc1cc(F)ccc1C1CNCCN1C(=O)N(C)C(C)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| Vestipitant mesylate (USAN) |
| Vestipitant Mesylate |
| UNII-OWR424W90Q |