n-4-fluorophenyl-3-(trifluoromethyl)benzamide structure
|
Common Name | n-4-fluorophenyl-3-(trifluoromethyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 33489-71-3 | Molecular Weight | 283.22100 | |
| Density | 1.374g/cm3 | Boiling Point | 268.3ºC at 760 mmHg | |
| Molecular Formula | C14H9F4NO | Melting Point | 101-102ºC | |
| MSDS | N/A | Flash Point | 116.1ºC | |
| Name | n-4-fluorophenyl-3-(trifluoromethyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.374g/cm3 |
|---|---|
| Boiling Point | 268.3ºC at 760 mmHg |
| Melting Point | 101-102ºC |
| Molecular Formula | C14H9F4NO |
| Molecular Weight | 283.22100 |
| Flash Point | 116.1ºC |
| Exact Mass | 283.06200 |
| PSA | 29.10000 |
| LogP | 4.16980 |
| Index of Refraction | 1.551 |
| InChIKey | SDBBNTCNOXEWLV-UHFFFAOYSA-N |
| SMILES | O=C(Nc1ccc(F)cc1)c1cccc(C(F)(F)F)c1 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4'-fluorophenyl-3-(trifluoromethyl)benzamide |