Potassium Di-tert-butylphosphate structure
|
Common Name | Potassium Di-tert-butylphosphate | ||
|---|---|---|---|---|
| CAS Number | 33494-80-3 | Molecular Weight | 248.298 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H18KO4P | Melting Point | 252 °C | |
| MSDS | Chinese USA | Flash Point | N/A | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | Potassium di-tert-butylphosphate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 252 °C |
|---|---|
| Molecular Formula | C8H18KO4P |
| Molecular Weight | 248.298 |
| Exact Mass | 248.057983 |
| PSA | 68.40000 |
| LogP | 3.15520 |
| Appearance of Characters | Powder | white |
| InChIKey | ZSWXMOQFFWMZQH-UHFFFAOYSA-M |
| SMILES | CC(C)(C)OP(=O)([O-])OC(C)(C)C.[K+] |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Hazard Codes | Xi |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2919900090 |
|
~%
Potassium Di-te... CAS#:33494-80-3 |
| Literature: Tetrahedron, , vol. 27, p. 3163 - 3170 |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| potassium di-tert-butyl phosphate |
| Potassium di-Tert-Butylphosphate |
| Potassium bis(2-methyl-2-propanyl) phosphate |
| PotassiuM di-t-butyl phosphate |
| Phosphoric acid di-tert-butyl ester,potassium salt |
| Phosphoric acid, bis(1,1-dimethylethyl) ester, potassium salt (1:1) |
| Di-t-Butylphosphate PotassiuM. |
| Di-tert-butylphosphate potassium salt |
| postassiuMdi-tert-butylphosphate |
| Di-tert-butyl phosphate |
| Di-t-butyl phosphate,potassium salt |
| DI-TERT-BUTYLPHOSPHATE,POTASSIUM SALT |