1,4-dibromooctafluorobutane structure
|
Common Name | 1,4-dibromooctafluorobutane | ||
|---|---|---|---|---|
| CAS Number | 335-48-8 | Molecular Weight | 359.83800 | |
| Density | 2,098 g/cm3 | Boiling Point | 97 °C | |
| Molecular Formula | C4Br2F8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96-98°C | |
| Name | 1,4-dibromo-1,1,2,2,3,3,4,4-octafluorobutane |
|---|---|
| Synonym | More Synonyms |
| Density | 2,098 g/cm3 |
|---|---|
| Boiling Point | 97 °C |
| Molecular Formula | C4Br2F8 |
| Molecular Weight | 359.83800 |
| Flash Point | 96-98°C |
| Exact Mass | 357.82400 |
| LogP | 4.23240 |
| Index of Refraction | 2.0979 |
| InChIKey | RWWUGYJWSVESJC-UHFFFAOYSA-N |
| SMILES | FC(F)(Br)C(F)(F)C(F)(F)C(F)(F)Br |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| HS Code | 2903799090 |
| Precursor 5 | |
|---|---|
| DownStream 8 | |
| HS Code | 2903799090 |
|---|---|
| Summary | 2903799090 halogenated derivatives of acyclic hydrocarbons containing two or more different halogens。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 1,4-Dibromooctafluorobutane |
| 1,4-Dibromoperfluorobutane |
| 1,4-dibromo-perfluorobutane |
| 1,4-Dibrom-octafluor-butan |
| MFCD00153112 |
| PC2279G |
| 1,4-dibromo-1,1,2,2,3,3,4,4-octafluoro-butane |