6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride
6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride structure
|
Common Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 335-52-4 | Molecular Weight | 332.49900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6ClF11O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 6-Chloro-2,2,3,3,4,4,5,5,6,6-Decafluorohexanoyl fluoride (Chinese name: 6-氯-2,2,3,3,4,4,5,5,6,6-十氟己酰氟), CAS number: 335-52-4, molecular formula: C6ClF11O, molecular weight: 332.49900. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6ClF11O |
|---|---|
| Molecular Weight | 332.49900 |
| Exact Mass | 331.94600 |
| PSA | 17.07000 |
| LogP | 3.85530 |
| InChIKey | VIFLLSOTNAVBFJ-UHFFFAOYSA-N |
| SMILES | O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
6-chloro-2,2,3,... CAS#:335-52-4 |
| Literature: Severson; Brice Journal of the American Chemical Society, 1958 , vol. 80, p. 2313,2316 |
|
~%
6-chloro-2,2,3,... CAS#:335-52-4 |
| Literature: Zapevalov,A.Ya. et al. Zhurnal Organicheskoi Khimii, 1978 , vol. 14, p. 259 - 262,239 - 242 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 6-Chlor-decafluor-hexanoylfluorid |
| 6-chloro-decafluoro-hexanoyl fluoride |
| Hexanoyl fluoride,6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride? |
| A: InChIKey of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride is VIFLLSOTNAVBFJ-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride? |
| A: SMILES notation of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride is O=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl. |
| Q: What are the upstream materials of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride? |
| A: Related upstream materials(CAS) of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride: 307-22-2;50838-69-2. |
| Q: What is the English name of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride? |
| A: The English name of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride is 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride. |
| Q: What is the LogP of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride? |
| A: LogP of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride is 3.85530. |
| Q: What English synonyms does 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride have? |
| A: English synonyms of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride: 6-Chlor-decafluor-hexanoylfluorid, 6-chloro-decafluoro-hexanoyl fluoride, Hexanoyl fluoride,6-chloro-2,2,3,3,4,4,5,5,6,6-decafluoro. |
| Q: What is the Chinese name of 335-52-4? |
| A: Chinese name of 335-52-4 is 335-52-4. |
| Q: What is the molecular weight of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride? |
| A: Molecular weight of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride is 332.49900. |
| Q: What is the polar surface area (PSA) of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride? |
| A: Polar surface area (PSA) of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride is 17.07000. |
| Q: What is the CAS number of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride? |
| A: CAS number of 6-chloro-2,2,3,3,4,4,5,5,6,6-decafluorohexanoyl fluoride is 335-52-4. |