1-CHLORO-6H-DODECAFLUOROHEXANE structure
|
Common Name | 1-CHLORO-6H-DODECAFLUOROHEXANE | ||
|---|---|---|---|---|
| CAS Number | 307-22-2 | Molecular Weight | 336.50600 | |
| Density | 1.641g/cm3 | Boiling Point | 109.5ºC at 760mmHg | |
| Molecular Formula | C6HClF12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 36.3ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.641g/cm3 |
|---|---|
| Boiling Point | 109.5ºC at 760mmHg |
| Molecular Formula | C6HClF12 |
| Molecular Weight | 336.50600 |
| Flash Point | 36.3ºC |
| Exact Mass | 335.95800 |
| LogP | 4.62430 |
| Index of Refraction | 1.284 |
| InChIKey | LENGESQCMOBFEV-UHFFFAOYSA-N |
| SMILES | FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 6 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| PC4677 |
| 6-Chloro-1H-perfluorohexane |
| 1-chloranyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecakis(fluoranyl)hexane |
| 1-chloro-1H,6H-dodecafluoro-hexane |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane? |
| A: LogP of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane is 4.62430. |
| Q: What are the upstream materials of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane? |
| A: Related upstream materials(CAS) of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane: 16486-97-8;107-13-1;97-63-2;140-88-5;10544-63-5;78-94-4;557-40-4;102-69-2;598-56-1;616-39-7. |
| Q: What is the SMILES notation of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane? |
| A: SMILES notation of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane is FC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)Cl. |
| Q: What English synonyms does 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane have? |
| A: English synonyms of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane: PC4677, 6-Chloro-1H-perfluorohexane, 1-chloranyl-1,1,2,2,3,3,4,4,5,5,6,6-dodecakis(fluoranyl)hexane, 1-chloro-1H,6H-dodecafluoro-hexane. |
| Q: What is the Chinese name of 307-22-2? |
| A: Chinese name of 307-22-2 is 307-22-2. |
| Q: What is the molecular weight of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane? |
| A: Molecular weight of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane is 336.50600. |
| Q: What is the boiling point of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane? |
| A: Boiling point of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane is 109.5ºC at 760mmHg. |
| Q: What is the molecular formula of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane? |
| A: Molecular formula of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane is C6HClF12. |
| Q: What is the InChIKey of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane? |
| A: InChIKey of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane is LENGESQCMOBFEV-UHFFFAOYSA-N. |
| Q: What is the English name of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane? |
| A: The English name of 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane is 1-chloro-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluorohexane. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |