Pentadecafluoroheptane-1-sulfonyl fluoride structure
|
Common Name | Pentadecafluoroheptane-1-sulfonyl fluoride | ||
|---|---|---|---|---|
| CAS Number | 335-71-7 | Molecular Weight | 452.11300 | |
| Density | 1.789g/cm3 | Boiling Point | 134ºC at 760 mmHg | |
| Molecular Formula | C7F16O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 34.8ºC | |
| Name | 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonyl fluoride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.789g/cm3 |
|---|---|
| Boiling Point | 134ºC at 760 mmHg |
| Molecular Formula | C7F16O2S |
| Molecular Weight | 452.11300 |
| Flash Point | 34.8ºC |
| Exact Mass | 451.93600 |
| PSA | 42.52000 |
| LogP | 5.69810 |
| Index of Refraction | 1.286 |
| InChIKey | FBIOXUYLJVKPPG-UHFFFAOYSA-N |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| HS Code | 2904909090 |
|---|
|
~%
Pentadecafluoro... CAS#:335-71-7 |
| Literature: Gramstad; Haszeldine Journal of the Chemical Society, 1957 , p. 2640,2642 |
|
~%
Pentadecafluoro... CAS#:335-71-7 |
| Literature: Gmelin Handbook: F: PerFHalOrg.2, 1.3.4, page 137 - 166 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| EINECS 206-398-4 |
| Pentadecafluor-heptan-1-sulfonylfluorid |
| Perfluorheptansulfonylfluorid |
| perfluoroheptane sulfonylfluoride |
| pentadecafluoro-heptane-1-sulfonyl fluoride |
| Pentadecafluoroheptane-1-sulphonyl fluoride |