Perfluoroheptanesulfonic acid structure
|
Common Name | Perfluoroheptanesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 375-92-8 | Molecular Weight | 450.12200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7HF15O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | perfluoroheptanesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C7HF15O3S |
|---|---|
| Molecular Weight | 450.12200 |
| Exact Mass | 449.94100 |
| PSA | 62.75000 |
| LogP | 5.28660 |
| InChIKey | OYGQVDSRYXATEL-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | C |
|---|---|
| HS Code | 2904909090 |
|
~%
Perfluoroheptan... CAS#:375-92-8 |
| Literature: Journal of the Chemical Society, , p. 2640,2642 |
|
~%
Perfluoroheptan... CAS#:375-92-8 |
| Literature: Gmelin Handbook: F: PerFHalOrg.SVol.3, 6.2.3.1, page 48 - 120 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| pentadecafluoroheptanesulfonic acid |
| Pentadecafluor-heptan-1-sulfonsaeure |
| 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-PENTADECAFLUOROHEPTANE-1-SULPHONIC ACID |
| pentadecafluoro-heptane-1-sulfonic acid |
| Perfluorheptan-sulfonsaeure |
| Pentadecafluor-heptansulfonsaeure |
| 1,1,2,2,3,3,4,4,5,5,6,6,7,7,7-pentadecafluoroheptane-1-sulfonic acid |
| Perfluoroheptanesulfonic acid |