1H,1H-PERFLUORO-N-DECYL ACRYLATE structure
|
Common Name | 1H,1H-PERFLUORO-N-DECYL ACRYLATE | ||
|---|---|---|---|---|
| CAS Number | 335-83-1 | Molecular Weight | 554.14700 | |
| Density | 1.603g/cm3 | Boiling Point | 66ºC 0,35mm | |
| Molecular Formula | C13H5F19O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 92.4ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.603g/cm3 |
|---|---|
| Boiling Point | 66ºC 0,35mm |
| Molecular Formula | C13H5F19O2 |
| Molecular Weight | 554.14700 |
| Flash Point | 92.4ºC |
| Exact Mass | 553.99900 |
| PSA | 26.30000 |
| LogP | 6.36030 |
| Index of Refraction | 1.3266 |
| InChIKey | QPVJROJBHCURKR-UHFFFAOYSA-N |
| SMILES | C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
1H,1H-PERFLUORO... CAS#:335-83-1 |
| Literature: US2642416 , ; |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2916129000 |
|---|---|
| Summary | 2916129000 other esters of acrylic acid VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-propenoic acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl ester |
| acrylic acid-(1H,1H-nonadecafluoro-decyl ester) |
| 1-Acryloyloxy-1H,1H-nonadecafluor-decan |
| Acrylsaeure-(1H,1H-nonadecafluor-decylester) |
| 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecakis(fluoranyl)decyl prop-2-enoate |
| PC9795 |
| 1H,1H-Perfluoro-n-decyl acrylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate? |
| A: CAS number of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate is 335-83-1. |
| Q: What is the molecular weight of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate? |
| A: Molecular weight of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate is 554.14700. |
| Q: What is the SMILES notation of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate? |
| A: SMILES notation of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate is C=CC(=O)OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F. |
| Q: What is the safety information for 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate? |
| A: Safety information for 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate: 26-36. |
| Q: What is the molecular formula of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate? |
| A: Molecular formula of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate is C13H5F19O2. |
| Q: What is the English name of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate? |
| A: The English name of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate is 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate. |
| Q: What is the polar surface area (PSA) of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate? |
| A: Polar surface area (PSA) of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate is 26.30000. |
| Q: What is the boiling point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate? |
| A: Boiling point of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate is 66ºC 0,35mm. |
| Q: What English synonyms does 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate have? |
| A: English synonyms of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate: 2-propenoic acid 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl ester, acrylic acid-(1H,1H-nonadecafluoro-decyl ester), 1-Acryloyloxy-1H,1H-nonadecafluor-decan, Acrylsaeure-(1H,1H-nonadecafluor-decylester), 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecakis(fluoranyl)decyl prop-2-enoate, PC9795, 1H,1H-Perfluoro-n-decyl acrylate. |
| Q: What is the InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate? |
| A: InChIKey of 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-nonadecafluorodecyl prop-2-enoate is QPVJROJBHCURKR-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |