ethane-1,2-diylbis(dichloromethylsilane) structure
|
Common Name | ethane-1,2-diylbis(dichloromethylsilane) | ||
|---|---|---|---|---|
| CAS Number | 3353-69-3 | Molecular Weight | 256.105 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 209.9±13.0 °C at 760 mmHg | |
| Molecular Formula | C4H10Cl4Si2 | Melting Point | 33-35ºC(lit.) | |
| MSDS | N/A | Flash Point | 79.9±14.6 °C | |
| Name | 1,2-bis(dichloromethylsilyl)ethane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 209.9±13.0 °C at 760 mmHg |
| Melting Point | 33-35ºC(lit.) |
| Molecular Formula | C4H10Cl4Si2 |
| Molecular Weight | 256.105 |
| Flash Point | 79.9±14.6 °C |
| Exact Mass | 253.907516 |
| LogP | 6.46 |
| Appearance of Characters | solid |
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
| Index of Refraction | 1.455 |
| InChIKey | VFURVLVRHAMJKG-UHFFFAOYSA-N |
| SMILES | C[Si](Cl)(Cl)CC[Si](C)(Cl)Cl |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | 26-28-36/37/39-45 |
| RIDADR | UN 2987 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| HS Code | 2931900090 |
|
~%
Detail
|
| Literature: US5072012 A1, ; |
|
~62%
ethane-1,2-diyl... CAS#:3353-69-3 |
| Literature: Doklady Chemistry, , vol. 254, p. 449 - 451 Dokl. Akad. Nauk SSSR Ser. Khim., , vol. 254, # 4 p. 887 - 890 |
|
~%
ethane-1,2-diyl... CAS#:3353-69-3 |
| Literature: Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , p. 1457,1461; engl. Ausg. S. 1478, 1481 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , p. 1150 ; engl. Ausg. S. 1175 |
|
~0%
ethane-1,2-diyl... CAS#:3353-69-3
Detail
|
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 55, # 8 p. 1795 - 1799,1594 - 1597 |
|
~3%
Detail
|
| Literature: J. Gen. Chem. USSR (Engl. Transl.), , vol. 55, # 8 p. 1795 - 1799,1594 - 1597 |
|
~88%
ethane-1,2-diyl... CAS#:3353-69-3 |
| Literature: Chizhova; Astapova; Petrovskii; Makarova Russian Chemical Bulletin, 2000 , vol. 49, # 8 p. 1430 - 1435 |
| Precursor 7 | |
|---|---|
| DownStream 3 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| 1,2-bis(dichloromethylsily)ethane |
| Ethylenebis(methyldichlorosilane) |
| Silane,1,2-ethanediylbis[dichloromethyl |
| ethane-1,2-diylbis(dichloromethylsilane) |
| 1,2-bis(dichloro(methyl)silyl)ethane |
| 1,2-ethanediylbis[dichloromethyl-Silane |
| Silane, 1,2-ethanediylbis[dichloromethyl- |
| Silane, 1,1'-(1,2-ethanediyl)bis[1,1-dichloro-1-methyl- |
| 1,2-Ethanediylbis[dichloro(methyl)silane] |
| 1,2-ethanediylbis[dichloromethyl-silan |
| Bis(1,2-methyldichlorosilyl)ethane |
| EINECS 222-123-0 |
| bis(methyldichlorosilyl)ethane |
| 1,2-BIS(METHYLDICHLOROSILYL)ETHANE |
| Ethane-1,2-diylbis[dichloro(methyl)silane] |
| ethylenebis(dichloromethylsilane) |
| 2,2,5,5-tetrachloro-2,5-disilahexane |