6-bromo-2-(2H-tetrazol-5-yl)chromen-4-one
Modify Date: 2025-11-03 12:39:38
6-bromo-2-(2H-tetrazol-5-yl)chromen-4-one structure
|
Common Name | 6-bromo-2-(2H-tetrazol-5-yl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 33544-21-7 | Molecular Weight | 293.07600 | |
| Density | 1.909g/cm3 | Boiling Point | 476ºC at 760 mmHg | |
| Molecular Formula | C10H5BrN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.7ºC | |
| Name | 6-bromo-2-(2H-tetrazol-5-yl)chromen-4-one |
|---|
| Density | 1.909g/cm3 |
|---|---|
| Boiling Point | 476ºC at 760 mmHg |
| Molecular Formula | C10H5BrN4O2 |
| Molecular Weight | 293.07600 |
| Flash Point | 241.7ºC |
| Exact Mass | 291.96000 |
| PSA | 84.67000 |
| LogP | 1.73560 |
| Index of Refraction | 1.719 |
| InChIKey | FHPXSLWCBTUXQN-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2nn[nH]n2)oc2ccc(Br)cc12 |
| HS Code | 2934999090 |
|---|
|
~%
6-bromo-2-(2H-t... CAS#:33544-21-7 |
| Literature: Ellis; Shaw Journal of medicinal chemistry, 1972 , vol. 15, # 8 p. 865 - 867 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |