6,8-dibromo-2-(2H-tetrazol-5-yl)chromen-4-one structure
|
Common Name | 6,8-dibromo-2-(2H-tetrazol-5-yl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 33550-08-2 | Molecular Weight | 371.97200 | |
| Density | 2.192g/cm3 | Boiling Point | 526.3ºC at 760 mmHg | |
| Molecular Formula | C10H4Br2N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 272.1ºC | |
| Name | 6,8-dibromo-2-(2H-tetrazol-5-yl)chromen-4-one |
|---|
| Density | 2.192g/cm3 |
|---|---|
| Boiling Point | 526.3ºC at 760 mmHg |
| Molecular Formula | C10H4Br2N4O2 |
| Molecular Weight | 371.97200 |
| Flash Point | 272.1ºC |
| Exact Mass | 369.87000 |
| PSA | 84.67000 |
| LogP | 2.49810 |
| Index of Refraction | 1.738 |
| InChIKey | YXMJERSBVSUMCI-UHFFFAOYSA-N |
| SMILES | O=c1cc(-c2nn[nH]n2)oc2c(Br)cc(Br)cc12 |
| HS Code | 2934999090 |
|---|
|
~%
6,8-dibromo-2-(... CAS#:33550-08-2 |
| Literature: Ellis; Shaw Journal of medicinal chemistry, 1972 , vol. 15, # 8 p. 865 - 867 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |