N,N,N',N',1-Pentamethyl-1-phenylsilanediamine structure
|
Common Name | N,N,N',N',1-Pentamethyl-1-phenylsilanediamine | ||
|---|---|---|---|---|
| CAS Number | 33567-83-8 | Molecular Weight | 208.375 | |
| Density | 0.9±0.1 g/cm3 | Boiling Point | 224.6±13.0 °C at 760 mmHg | |
| Molecular Formula | C11H20N2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 89.6±19.8 °C | |
| Name | N-[benzyl(dimethylamino)silyl]-N-methylmethanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 0.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 224.6±13.0 °C at 760 mmHg |
| Molecular Formula | C11H20N2Si |
| Molecular Weight | 208.375 |
| Flash Point | 89.6±19.8 °C |
| Exact Mass | 208.139572 |
| PSA | 6.48000 |
| LogP | 2.49 |
| Vapour Pressure | 0.1±0.4 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | BDSUYTOTVCEJPO-UHFFFAOYSA-N |
| SMILES | CN(C)[Si](C)(c1ccccc1)N(C)C |
| Risk Phrases | 36/37/38 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2931900090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Silanediamine,N,N,N',N',1-pentamethyl-1-phenyl |
| Silanediamine, N,N,N',N',1-pentamethyl-1-phenyl- |
| N,N,N',N',1-Pentamethyl-1-phenylsilanediamine |