Chloroperfluorocyclohexane structure
|
Common Name | Chloroperfluorocyclohexane | ||
|---|---|---|---|---|
| CAS Number | 336-15-2 | Molecular Weight | 316.50000 | |
| Density | 1.75g/cm3 | Boiling Point | 89ºC at 760 mmHg | |
| Molecular Formula | C6ClF11 | Melting Point | 30-31ºC | |
| MSDS | N/A | Flash Point | 19.9ºC | |
| Name | Chloroperfluorocyclohexane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 89ºC at 760 mmHg |
| Melting Point | 30-31ºC |
| Molecular Formula | C6ClF11 |
| Molecular Weight | 316.50000 |
| Flash Point | 19.9ºC |
| Exact Mass | 315.95100 |
| LogP | 4.08110 |
| Index of Refraction | 1.302 |
| InChIKey | KGZKBHYAEBRMAR-UHFFFAOYSA-N |
| SMILES | FC1(F)C(F)(F)C(F)(F)C(F)(Cl)C(F)(F)C1(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2903890090 |
| HS Code | 2903890090 |
|---|---|
| Summary | 2903890090. halogenated derivatives of cyclanic, cyclenic or cyclotherpenic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1-chloro-1,2,2,3,3,4,4,5,5,6,6-undecafluorocyclohexane |