Butralin structure
|
Common Name | Butralin | ||
|---|---|---|---|---|
| CAS Number | 33629-47-9 | Molecular Weight | 295.33 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 381.3±42.0 °C at 760 mmHg | |
| Molecular Formula | C14H21N3O4 | Melting Point | 61ºC | |
| MSDS | Chinese USA | Flash Point | 184.4±27.9 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
Use of ButralinButralin is a dinitroaniline herbicide that can be widely used to control single-leaf weeds and some dicotyledons[1]. |
| Name | butralin |
|---|---|
| Synonym | More Synonyms |
| Description | Butralin is a dinitroaniline herbicide that can be widely used to control single-leaf weeds and some dicotyledons[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 381.3±42.0 °C at 760 mmHg |
| Melting Point | 61ºC |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.33 |
| Flash Point | 184.4±27.9 °C |
| Exact Mass | 295.153198 |
| PSA | 103.67000 |
| LogP | 5.80 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | SPNQRCTZKIBOAX-UHFFFAOYSA-N |
| SMILES | CCC(C)Nc1c([N+](=O)[O-])cc(C(C)(C)C)cc1[N+](=O)[O-] |
| Storage condition | 0-6°C |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319-H341-H410 |
| Precautionary Statements | P273-P281-P305 + P351 + P338-P501 |
| Personal Protective Equipment | Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T: Toxic;N: Dangerous for the environment; |
| Risk Phrases | 24-36/37/38-50/53 |
| Safety Phrases | S26-S36/37-S45-S60-S61 |
| RIDADR | 1325 |
| RTECS | BW9500000 |
| Packaging Group | II |
| Hazard Class | 4.1 |
| HS Code | 2921499012 |
|
~93%
Butralin CAS#:33629-47-9 |
| Literature: Union Carbide Corporation Patent: US4395572 A1, 1983 ; |
|
~%
Butralin CAS#:33629-47-9 |
| Literature: US3991116 A1, ; |
|
~%
Butralin CAS#:33629-47-9 |
| Literature: US3991116 A1, ; |
|
~%
Butralin CAS#:33629-47-9 |
| Literature: US5663441 A1, ; |
| HS Code | 2921499012 |
|---|---|
| Summary | 2921499012. VAT:17.0%. Tax rebate rate:9.0%. Supervision conditions:S(import or export registration certificate for pesticides). MFN tariff:6.5%. General tariff:30.0% |
|
Simultaneous residue measurement of pendimethalin, isopropalin, and butralin in tobacco using high-performance liquid chromatography with ultraviolet detection and electrospray ionization/mass spectrometric identification.
J. Agric. Food Chem. 52(23) , 6912-5, (2004) A simultaneous residue analysis of pendimethalin, isopropalin, and butralin in tobacco was developed with high-performance liquid chromatography with ultraviolet monitoring and electrospray ionization... |
|
|
[Chemical weed control of medicinal plant Bupleurum falcatum L].
Zhongguo Zhong Yao Za Zhi 25(4) , 210-3, (2000) To select low-residue herbicide for cultivation of Bupleurum falcatum.Probing the effect of various kinds of herbicide on the budding, growth and yield of B. falcatum both in laboratory and in the fie... |
|
|
Alpha-tubulin missense mutations correlate with antimicrotubule drug resistance in Eleusine indica.
Plant Cell 10(2) , 297-308, (1998) Dinitroaniline herbicides are antimicrotubule drugs that bind to tubulins and inhibit polymerization. As a result of repeated application of dinitroaniline herbicides, highly resistant and intermediat... |
| AMEX |
| 4-tert-butyl-n-sec-butyl-2,6-dinitroaniline |
| N-sec-Butyl-4-tert-butyl-2,6-dinitroanilin |
| Amchem A-280 |
| 4-tert-butyl-N-(1-methylpropyl)-2,6-dinitroaniline |
| Rutralin |
| Amchem A 280 |
| Zitsaosol |
| N-(butan-2-yl)-4-tert-butyl-2,6-dinitroaniline |
| (RS)-N-sec-butyl-4-tert-butyl-2,6-dinitroaniline |
| N-butan-2-yl-4-tert-butyl-2,6-dinitroaniline |
| Butalin |
| N-sec-Butyl-4-(2-methyl-2-propanyl)-2,6-dinitroaniline |
| 4-tert-butyl-2,6-dinitro-N-sec-butylaniline |
| N-sec-Butyl-4-tert-butyl-2,6-dinitroaniline |
| 4-(1,1-dimethylethyl)-N-(1-methylpropyl)-2,6-dinitrobenzenamine |
| Butralin |
| MFCD00128046 |
| Dibutalin |
| EINECS 251-607-4 |
| rac-N-[(2R)-butan-2-yl]-4-tert-butyl-2,6-dinitroaniline |
| Amchem 70-25 |
| Amchem-70-25 |
| Butraline |
| N-(Sec-butyl)-4-(tert-butyl)-2,6-dinitroaniline |
| Tamex |