4-[(3-methoxyanilino)methylidene]cyclohexa-2,5-dien-1-one structure
|
Common Name | 4-[(3-methoxyanilino)methylidene]cyclohexa-2,5-dien-1-one | ||
|---|---|---|---|---|
| CAS Number | 33630-16-9 | Molecular Weight | 227.25900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(3-methoxyanilino)methylidene]cyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H13NO2 |
|---|---|
| Molecular Weight | 227.25900 |
| Exact Mass | 227.09500 |
| PSA | 38.33000 |
| LogP | 2.75910 |
| InChIKey | KGGMWVBGURKNQZ-UHFFFAOYSA-N |
| SMILES | COc1cccc(N=Cc2ccc(O)cc2)c1 |
| HS Code | 2925290090 |
|---|
|
~%
4-[(3-methoxyan... CAS#:33630-16-9 |
| Literature: Ingle; Upadhyay; Kharche Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2004 , vol. 43, # 8 p. 1743 - 1747 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| hms1541k04 |