(methoxymethyl)triphenylphosphanium bromide structure
|
Common Name | (methoxymethyl)triphenylphosphanium bromide | ||
|---|---|---|---|---|
| CAS Number | 33670-32-5 | Molecular Weight | 387.25000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H20BrOP | Melting Point | 175-179 ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methoxymethyl(triphenyl)phosphanium,bromide |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 175-179 ºC |
|---|---|
| Molecular Formula | C20H20BrOP |
| Molecular Weight | 387.25000 |
| Exact Mass | 386.04400 |
| PSA | 22.82000 |
| LogP | 0.58840 |
| InChIKey | NOCGROPYCGRERZ-UHFFFAOYSA-M |
| SMILES | COC[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-] |
| Hazard Codes | C: Corrosive;Xi: Irritant; |
|---|---|
| Risk Phrases | R14 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 1390 4.3/PG 2 |
| HS Code | 2931900090 |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| (methoxymethyl)triphenylphosphanium bromide |
| Ph3P(CH2OMe)Br |
| triphenylmethoxymethylphosphonium bromide |
| (methoxymethyl)triphenylphosphonium chloride |
| (methoxymethyl)-triphenyl-phosphonium bromide |