triphenyl(phenylimino)-λ5-arsane structure
|
Common Name | triphenyl(phenylimino)-λ5-arsane | ||
|---|---|---|---|---|
| CAS Number | 33708-54-2 | Molecular Weight | 397.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H20AsN | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triphenyl(phenylimino)-λ5-arsane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H20AsN |
|---|---|
| Molecular Weight | 397.34400 |
| Exact Mass | 397.08100 |
| PSA | 12.36000 |
| LogP | 4.25380 |
| InChIKey | XYHCARWHLRAMPT-UHFFFAOYSA-N |
| SMILES | c1ccc(N=[As](c2ccccc2)(c2ccccc2)c2ccccc2)cc1 |
|
~87%
triphenyl(pheny... CAS#:33708-54-2 |
| Literature: Kokorev, G. I.; Yambushev, F. D.; Badrutdinov, Sh. Kh. J. Gen. Chem. USSR (Engl. Transl.), 1986 , vol. 56, # 8 p. 1794 - 1798,1587 - 1590 |
|
~%
triphenyl(pheny... CAS#:33708-54-2 |
| Literature: Froeyen, Paul Phosphorus, Sulfur and Silicon and the Related Elements, 1993 , vol. 81, # 1-4 p. 37 - 48 |
| Precursor 3 | |
|---|---|
| DownStream 7 | |
| tetraphenylarsine imide |
| triphenylarsenazophenyl |
| Triphenylarsin phenylimin |
| anilino-triphenyl-arsonium betaine |