Benzenamine,N,N-dimethyl-4-[(phenylimino)methyl]
![Benzenamine,N,N-dimethyl-4-[(phenylimino)methyl] Structure](https://image.chemsrc.com/caspic/229/889-37-2.png)
Benzenamine,N,N-dimethyl-4-[(phenylimino)methyl] structure
|
Common Name | Benzenamine,N,N-dimethyl-4-[(phenylimino)methyl] | ||
|---|---|---|---|---|
| CAS Number | 889-37-2 | Molecular Weight | 224.30100 | |
| Density | 0.97g/cm3 | Boiling Point | 363.8ºC at 760 mmHg | |
| Molecular Formula | C15H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.8ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-[p-(Dimethylamino)benzylidene]aniline |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 363.8ºC at 760 mmHg |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.30100 |
| Flash Point | 173.8ºC |
| Exact Mass | 224.13100 |
| PSA | 15.60000 |
| LogP | 3.50320 |
| Index of Refraction | 1.547 |
| InChIKey | MFFDJRYGVWMCQY-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C=Nc2ccccc2)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 7 | |
|---|---|
| DownStream 10 | |
CAS#:100-10-7
CAS#:1703-46-4
CAS#:33708-54-2
CAS#:103-71-9
CAS#:157119-18-1
CAS#:63756-72-9
CAS#:71-43-2![1H-Indene-1,3(2H)-dione,2-[[4-(dimethylamino)phenyl]methylene] structure](https://image.chemsrc.com/caspic/176/21889-13-4.png)
CAS#:21889-13-4
CAS#:99-97-8
CAS#:1227476-15-4
CAS#:536-17-4![2-[4-(Dimethylamino)styryl]-1-methylquinolinium iodide structure](https://image.chemsrc.com/caspic/498/3915-61-5.png)
CAS#:3915-61-5![1,3-Dioxane-4,6-dione,5-[[4-(dimethylamino)phenyl]methylene]-2,2-dimethyl structure](https://image.chemsrc.com/caspic/167/15795-57-0.png)
CAS#:15795-57-0
CAS#:13041-79-7![2,4,6(1H,3H,5H)-Pyrimidinetrione,5-[[4-(dimethylamino)phenyl]methylene] structure](https://image.chemsrc.com/caspic/064/1753-47-5.png)
CAS#:1753-47-5
CAS#:1149-18-4This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| p-dimethylaminobenzaldehyde adduct of aniline |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of N-[p-(Dimethylamino)benzylidene]aniline? |
| A: Related downstream products(CAS) of N-[p-(Dimethylamino)benzylidene]aniline: 21889-13-4;99-97-8;100-10-7;1227476-15-4;536-17-4;3915-61-5;15795-57-0;13041-79-7;1753-47-5;1149-18-4. |
| Q: What is the Chinese name of 889-37-2? |
| A: Chinese name of 889-37-2 is 889-37-2. |
| Q: What is the molecular weight of N-[p-(Dimethylamino)benzylidene]aniline? |
| A: Molecular weight of N-[p-(Dimethylamino)benzylidene]aniline is 224.30100. |
| Q: What is the molecular formula of N-[p-(Dimethylamino)benzylidene]aniline? |
| A: Molecular formula of N-[p-(Dimethylamino)benzylidene]aniline is C15H16N2. |
| Q: What is the English name of N-[p-(Dimethylamino)benzylidene]aniline? |
| A: The English name of N-[p-(Dimethylamino)benzylidene]aniline is N-[p-(Dimethylamino)benzylidene]aniline. |
| Q: What is the boiling point of N-[p-(Dimethylamino)benzylidene]aniline? |
| A: Boiling point of N-[p-(Dimethylamino)benzylidene]aniline is 363.8ºC at 760 mmHg. |
| Q: What is the SMILES notation of N-[p-(Dimethylamino)benzylidene]aniline? |
| A: SMILES notation of N-[p-(Dimethylamino)benzylidene]aniline is CN(C)c1ccc(C=Nc2ccccc2)cc1. |
| Q: What is the CAS number of N-[p-(Dimethylamino)benzylidene]aniline? |
| A: CAS number of N-[p-(Dimethylamino)benzylidene]aniline is 889-37-2. |
| Q: What English synonyms does N-[p-(Dimethylamino)benzylidene]aniline have? |
| A: English synonyms of N-[p-(Dimethylamino)benzylidene]aniline: p-dimethylaminobenzaldehyde adduct of aniline. |
| Q: What is the InChIKey of N-[p-(Dimethylamino)benzylidene]aniline? |
| A: InChIKey of N-[p-(Dimethylamino)benzylidene]aniline is MFFDJRYGVWMCQY-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |