Benzenamine,N,N-dimethyl-4-[(phenylimino)methyl]- structure
|
Common Name | Benzenamine,N,N-dimethyl-4-[(phenylimino)methyl]- | ||
|---|---|---|---|---|
| CAS Number | 889-37-2 | Molecular Weight | 224.30100 | |
| Density | 0.97g/cm3 | Boiling Point | 363.8ºC at 760 mmHg | |
| Molecular Formula | C15H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.8ºC | |
| Name | N-[p-(Dimethylamino)benzylidene]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 0.97g/cm3 |
|---|---|
| Boiling Point | 363.8ºC at 760 mmHg |
| Molecular Formula | C15H16N2 |
| Molecular Weight | 224.30100 |
| Flash Point | 173.8ºC |
| Exact Mass | 224.13100 |
| PSA | 15.60000 |
| LogP | 3.50320 |
| Index of Refraction | 1.547 |
| InChIKey | MFFDJRYGVWMCQY-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C=Nc2ccccc2)cc1 |
| Precursor 7 | |
|---|---|
| DownStream 10 | |
| p-dimethylaminobenzaldehyde adduct of aniline |