Acetamide,2,2,2-trichloro-N-(2,5-dichlorophenyl)- structure
|
Common Name | Acetamide,2,2,2-trichloro-N-(2,5-dichlorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 33715-64-9 | Molecular Weight | 307.38800 | |
| Density | 1.701g/cm3 | Boiling Point | 370ºC at 760mmHg | |
| Molecular Formula | C8H4Cl5NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.6ºC | |
| Name | 2,2,2-trichloro-N-(2,5-dichlorophenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.701g/cm3 |
|---|---|
| Boiling Point | 370ºC at 760mmHg |
| Molecular Formula | C8H4Cl5NO |
| Molecular Weight | 307.38800 |
| Flash Point | 177.6ºC |
| Exact Mass | 304.87400 |
| PSA | 29.10000 |
| LogP | 4.37510 |
| Index of Refraction | 1.636 |
| InChIKey | WKBFRYPEBOWXGM-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)C(Cl)(Cl)Cl |
| 2,5-dichloroanilide of trichloroacetic acid |
| 2,2,2-trichloro-N-(2,5-dichlorophenyl)-acetamide |
| N-(2,5-dichlorophenyl)-2,2,2,-trichloroacetamide |