4-(3-(Trifluoromethyl)phenoxy)piperidine
Modify Date: 2024-09-14 00:46:09
4-(3-(Trifluoromethyl)phenoxy)piperidine structure
|
Common Name | 4-(3-(Trifluoromethyl)phenoxy)piperidine | ||
|---|---|---|---|---|
| CAS Number | 337912-66-0 | Molecular Weight | 245.24100 | |
| Density | 1.193g/cm3 | Boiling Point | 290.742ºC at 760 mmHg | |
| Molecular Formula | C12H14F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 129.637ºC | |
| Name | 4-[3-(trifluoromethyl)phenoxy]piperidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.193g/cm3 |
|---|---|
| Boiling Point | 290.742ºC at 760 mmHg |
| Molecular Formula | C12H14F3NO |
| Molecular Weight | 245.24100 |
| Flash Point | 129.637ºC |
| Exact Mass | 245.10300 |
| PSA | 21.26000 |
| LogP | 3.16500 |
| Index of Refraction | 1.473 |
| InChIKey | BYJVBLFZMKBFMT-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(OC2CCNCC2)c1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-(3-(Trifluoromethyl)phenoxy)piperidine |
| 4-(m-Trifluormethylphenoxy)-piperidin |
| 4-(3-Trifluormethylphenoxy)-piperidin |