4-[3-(Trifluoromethyl)phenoxy]aniline structure
|
Common Name | 4-[3-(Trifluoromethyl)phenoxy]aniline | ||
|---|---|---|---|---|
| CAS Number | 41605-31-6 | Molecular Weight | 253.220 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 321.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C13H10F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.5±27.9 °C | |
| Name | 4-[3-(Trifluoromethyl)phenoxy]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 321.9±42.0 °C at 760 mmHg |
| Molecular Formula | C13H10F3NO |
| Molecular Weight | 253.220 |
| Flash Point | 148.5±27.9 °C |
| Exact Mass | 253.071442 |
| PSA | 35.25000 |
| LogP | 2.35 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.545 |
| InChIKey | VPVKXXRMSWUGHE-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2cccc(C(F)(F)F)c2)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2922299090 |
|---|
|
~%
4-[3-(Trifluoro... CAS#:41605-31-6 |
| Literature: Chee, Gaik-Lean; Dekeyser, Mark A.; Seebold JR., Kenneth W.; Osika, Ewa Maria; Brouwer, Walter G.; Park, Sheldon B.; Lai, Hoi Kiong Patent: US2004/266738 A1, 2004 ; Location in patent: Page 5 ; |
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenamine, 4-[3-(trifluoromethyl)phenoxy]- |
| 4-(m-trifluoromethylphenoxy)-aniline |
| 4-[3-(trifluoromethyl)phenoxy]benzenamine |
| 4-[3-(Trifluoromethyl)phenoxy]aniline |
| 4-(3'-trifluoromethylphenoxy)aniline |