β-Chloro-4-nitrophenethole structure
|
Common Name | β-Chloro-4-nitrophenethole | ||
|---|---|---|---|---|
| CAS Number | 3383-72-0 | Molecular Weight | 201.607 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 332.1±17.0 °C at 760 mmHg | |
| Molecular Formula | C8H8ClNO3 | Melting Point | 57-66°C | |
| MSDS | N/A | Flash Point | 154.6±20.9 °C | |
| Name | 1-(2-Chloroethoxy)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 332.1±17.0 °C at 760 mmHg |
| Melting Point | 57-66°C |
| Molecular Formula | C8H8ClNO3 |
| Molecular Weight | 201.607 |
| Flash Point | 154.6±20.9 °C |
| Exact Mass | 201.019272 |
| PSA | 55.05000 |
| LogP | 2.49 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | OBCFOPGCTNULTG-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(OCCCl)cc1 |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2909309090 |
|
~64%
β-Chloro-4-nitr... CAS#:3383-72-0 |
| Literature: IRM LLC; NOVARTIS, AG Patent: WO2007/38669 A2, 2007 ; Location in patent: Page/Page column 170 ; |
|
~%
β-Chloro-4-nitr... CAS#:3383-72-0 |
| Literature: US4891372 A1, ; |
|
~%
β-Chloro-4-nitr... CAS#:3383-72-0 |
| Literature: US2002/55524 A1, ; |
|
~%
β-Chloro-4-nitr... CAS#:3383-72-0 |
| Literature: US2002/28832 A1, ; US 20020028832 A1 |
|
~%
β-Chloro-4-nitr... CAS#:3383-72-0 |
| Literature: Journal of the Indian Chemical Society, , vol. 13, p. 334 |
|
~%
β-Chloro-4-nitr... CAS#:3383-72-0 |
| Literature: US5138054 A1, ; |
|
~70%
β-Chloro-4-nitr... CAS#:3383-72-0 |
| Literature: Sukalovic; Andric, Deana; Roglic; Kostic-Rajacic, Sladjana; Schrattenholz; Soskic European Journal of Medicinal Chemistry, 2005 , vol. 40, # 5 p. 481 - 493 |
|
~%
β-Chloro-4-nitr... CAS#:3383-72-0 |
| Literature: Journal of the Indian Chemical Society, , vol. 13, p. 334 |
|
~%
β-Chloro-4-nitr... CAS#:3383-72-0 |
| Literature: J. Med. Chem., , vol. 6, p. 343 - 346 |
| Precursor 9 | |
|---|---|
| DownStream 10 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-nitro-(2-chloroethoxy)benzene |
| 2-Chloroethyl4-nitrophenylether |
| 2-Chloroethyl 4-nitrophenyl ether |
| BETA-CHLORO-4-NITROPHENETHOLE |
| MFCD00674505 |
| (2-chloro-ethyl)-(4-nitro-phenyl)-ether |
| 4-Nitrophenyl 2-chloroethyl ether |
| 2-(4-nitrophenoxy)ethyl chloride |
| Benzene, 1-(2-chloroethoxy)-4-nitro- |
| WNR DO2G |
| chloroethoxynitrobenzene |
| 1-(2-Chloroethoxy)-4-nitrobenzene |
| β-Chloro-4-nitrophenethole |
| 4-(2'-chloroethoxy)-nitrobenzene |
| EINECS 425-790-8 |