diethyl 2-(3-bromopropyl)-2-phenyl-propanedioate structure
|
Common Name | diethyl 2-(3-bromopropyl)-2-phenyl-propanedioate | ||
|---|---|---|---|---|
| CAS Number | 33837-55-7 | Molecular Weight | 357.24000 | |
| Density | 1.297g/cm3 | Boiling Point | 403.8ºC at 760 mmHg | |
| Molecular Formula | C16H21BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198ºC | |
| Name | diethyl 2-(3-bromopropyl)-2-phenylpropanedioate |
|---|
| Density | 1.297g/cm3 |
|---|---|
| Boiling Point | 403.8ºC at 760 mmHg |
| Molecular Formula | C16H21BrO4 |
| Molecular Weight | 357.24000 |
| Flash Point | 198ºC |
| Exact Mass | 356.06200 |
| PSA | 52.60000 |
| LogP | 3.22570 |
| Index of Refraction | 1.52 |
| InChIKey | LLEWSGAUVREMCE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCCBr)(C(=O)OCC)c1ccccc1 |
| HS Code | 2917399090 |
|---|
|
~%
diethyl 2-(3-br... CAS#:33837-55-7 |
| Literature: Skinner Journal of the American Chemical Society, 1937 , vol. 59, p. 322 |
|
~%
diethyl 2-(3-br... CAS#:33837-55-7 |
| Literature: Skinner Journal of the American Chemical Society, 1937 , vol. 59, p. 322 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |