Diethyl phenylmalonate structure
|
Common Name | Diethyl phenylmalonate | ||
|---|---|---|---|---|
| CAS Number | 83-13-6 | Molecular Weight | 236.264 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 301.0±22.0 °C at 760 mmHg | |
| Molecular Formula | C13H16O4 | Melting Point | 16 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 141.8±20.7 °C | |
| Name | Diethyl phenylmalonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.0±22.0 °C at 760 mmHg |
| Melting Point | 16 °C(lit.) |
| Molecular Formula | C13H16O4 |
| Molecular Weight | 236.264 |
| Flash Point | 141.8±20.7 °C |
| Exact Mass | 236.104858 |
| PSA | 52.60000 |
| LogP | 2.71 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.500 |
| InChIKey | FGYDHYCFHBSNPE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C(=O)OCC)c1ccccc1 |
| Water Solubility | immiscible |
| Personal Protective Equipment | Eyeshields;Gloves;half-mask respirator (US);multi-purpose combination respirator cartridge (US) |
|---|---|
| Hazard Codes | Xi |
| Safety Phrases | S23-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2942000000 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Synthesis of deuterium?labeled felbamate from diethyl phenylmalonate. Choi YM, et al.
J. Labelled Comp. Radiopharm. 23(7) , 785-789, (1986)
|
|
|
Partial and enantioselective hydrolysis of diethyl phenylmalonate by immobilized preparations of lipase from Thermomyces lanuginose.
Enz. Microbiol. Technol. 40(5) , 1280-1285, (2007)
|
| EINECS 201-456-5 |
| diethyl phenylpropanedioate |
| Propanedioic acid, phenyl-, diethyl ester |
| Diethyl phenylmalonate |
| Diethyl 2-phenylmalonate |
| Propanedioic acid, 2-phenyl-, diethyl ester |
| Malonic acid, phenyl-, diethyl ester |
| MFCD00009144 |
| diethyl 2-phenylpropanedioate |
| Malonic acid, phenyl-, diethyl ester (8CI) |