methylthioadenosine sulfoxide
methylthioadenosine sulfoxide structure
|
Common Name | methylthioadenosine sulfoxide | ||
|---|---|---|---|---|
| CAS Number | 3387-65-3 | Molecular Weight | 313.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 5'-Deoxy-5'-methylsulphinyladenosine (also known as methylthioadenosine sulfoxide), Chinese name: 5'-脱氧-5'-甲基磺酰腺苷, CAS number: 3387-65-3, molecular formula: C11H15N5O4S, molecular weight: 313.33300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5'-Deoxy-5'-methylsulphinyladenosine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H15N5O4S |
|---|---|
| Molecular Weight | 313.33300 |
| Exact Mass | 313.08400 |
| PSA | 155.59000 |
| InChIKey | WXOJULRVRHWMGT-JLQSGANNSA-N |
| SMILES | CS(=O)CC1OC(n2cnc3c(N)ncnc32)C(O)C1O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:2457-80-9
CAS#:118560-47-7This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5'-Deoxy-5'-methylsulphinyladenosine? |
| A: Molecular formula of 5'-Deoxy-5'-methylsulphinyladenosine is C11H15N5O4S. |
| Q: What is the molecular weight of 5'-Deoxy-5'-methylsulphinyladenosine? |
| A: Molecular weight of 5'-Deoxy-5'-methylsulphinyladenosine is 313.33300. |
| Q: What is the SMILES notation of 5'-Deoxy-5'-methylsulphinyladenosine? |
| A: SMILES notation of 5'-Deoxy-5'-methylsulphinyladenosine is CS(=O)CC1OC(n2cnc3c(N)ncnc32)C(O)C1O. |
| Q: What is the English name of 5'-Deoxy-5'-methylsulphinyladenosine? |
| A: The English name of 5'-Deoxy-5'-methylsulphinyladenosine is 5'-Deoxy-5'-methylsulphinyladenosine. |
| Q: What is the polar surface area (PSA) of 5'-Deoxy-5'-methylsulphinyladenosine? |
| A: Polar surface area (PSA) of 5'-Deoxy-5'-methylsulphinyladenosine is 155.59000. |
| Q: What is the InChIKey of 5'-Deoxy-5'-methylsulphinyladenosine? |
| A: InChIKey of 5'-Deoxy-5'-methylsulphinyladenosine is WXOJULRVRHWMGT-JLQSGANNSA-N. |
| Q: What is the Chinese name of 3387-65-3? |
| A: Chinese name of 3387-65-3 is 3387-65-3. |
| Q: What is the CAS number of 5'-Deoxy-5'-methylsulphinyladenosine? |
| A: CAS number of 5'-Deoxy-5'-methylsulphinyladenosine is 3387-65-3. |
| Q: What are the downstream products of 5'-Deoxy-5'-methylsulphinyladenosine? |
| A: Related downstream products(CAS) of 5'-Deoxy-5'-methylsulphinyladenosine: 2457-80-9;118560-47-7. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |