1-tert-Butyl 3-methyl 1H-indole-1,3-dicarboxylate structure
|
Common Name | 1-tert-Butyl 3-methyl 1H-indole-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 338760-26-2 | Molecular Weight | 275.300 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 387.3±34.0 °C at 760 mmHg | |
| Molecular Formula | C15H17NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.0±25.7 °C | |
| Name | 1-O-tert-butyl 3-O-methyl indole-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 387.3±34.0 °C at 760 mmHg |
| Molecular Formula | C15H17NO4 |
| Molecular Weight | 275.300 |
| Flash Point | 188.0±25.7 °C |
| Exact Mass | 275.115753 |
| PSA | 57.53000 |
| LogP | 3.84 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.543 |
| InChIKey | VOWZQOSRBMJMJM-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cn(C(=O)OC(C)(C)C)c2ccccc12 |
| Hazard Codes | Xi |
|---|
|
~96%
1-tert-Butyl 3-... CAS#:338760-26-2 |
| Literature: GRUeNENTHAL GMBH Patent: WO2009/103552 A1, 2009 ; Location in patent: Page/Page column 31 ; |
|
~62%
1-tert-Butyl 3-... CAS#:338760-26-2 |
| Literature: Koos, Peter; Gross, Ulrike; Polyzos, Anastasios; O'Brien, Matthew; Baxendale, Ian; Ley, Steven V. Organic and Biomolecular Chemistry, 2011 , vol. 9, # 20 p. 6903 - 6908 |
| Precursor 5 | |
|---|---|
| DownStream 5 | |
| AB1511 |
| 3-Methyl 1-(2-methyl-2-propanyl) 1H-indole-1,3-dicarboxylate |
| N-BOC methyl indole-3-carboxylate |
| Indole-1,3-dicarboxylic acid 1-tert-butyl ester 3-methyl ester |
| METHYL 1-BOC-1H-INDOLE-3-CARBOXYLATE |
| 1H-Indole-1,3-dicarboxylic acid, 1-(1,1-dimethylethyl) 3-methyl ester |