2-Amino-1-(4-(trifluoromethyl)phenyl)ethanone hydrochloride structure
|
Common Name | 2-Amino-1-(4-(trifluoromethyl)phenyl)ethanone hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 339-58-2 | Molecular Weight | 239.622 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9ClF3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-amino-1-[4-(trifluoromethyl)phenyl]ethanone,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H9ClF3NO |
|---|---|
| Molecular Weight | 239.622 |
| Exact Mass | 239.032471 |
| PSA | 43.09000 |
| LogP | 3.34910 |
| InChIKey | APBKZMJARWKEJO-UHFFFAOYSA-N |
| SMILES | Cl.NCC(=O)c1ccc(C(F)(F)F)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922399090 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| QC-3700 |
| 2-amino-1-[4-(trifluoromethyl)phenyl]-1-ethanone hydrogen chloride |
| 2-Amino-4'-trifluoromethylacetophenone HCl |
| 2-Amino-1-[4-(trifluoromethyl)phenyl]ethanone hydrochloride (1:1) |
| FD7405 |
| 2-Amino-1-(4-trifluormethyl-phenyl)-aethanon,Hydrochlorid |
| Ethanone, 2-amino-1-[4-(trifluoromethyl)phenyl]-, hydrochloride (1:1) |