6-Nitro-3-(4-pyridyl)coumarin structure
|
Common Name | 6-Nitro-3-(4-pyridyl)coumarin | ||
|---|---|---|---|---|
| CAS Number | 3390-70-3 | Molecular Weight | 268.22400 | |
| Density | 1.455g/cm3 | Boiling Point | 515.2ºC at 760 mmHg | |
| Molecular Formula | C14H8N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.4ºC | |
| Name | 6-nitro-3-pyridin-4-ylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.455g/cm3 |
|---|---|
| Boiling Point | 515.2ºC at 760 mmHg |
| Molecular Formula | C14H8N2O4 |
| Molecular Weight | 268.22400 |
| Flash Point | 265.4ºC |
| Exact Mass | 268.04800 |
| PSA | 88.92000 |
| LogP | 3.28640 |
| Index of Refraction | 1.669 |
| InChIKey | LJYXKUOCGUAQEH-UHFFFAOYSA-N |
| SMILES | O=c1oc2ccc([N+](=O)[O-])cc2cc1-c1ccncc1 |
| HS Code | 2934999090 |
|---|
|
~%
6-Nitro-3-(4-py... CAS#:3390-70-3 |
| Literature: Moffett,R.B. Journal of Medicinal Chemistry, 1964 , vol. 7, p. 446 - 449 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-nitro-3-pyridin-4-yl-chromen-2-one |
| 6-Nitro-3-<4-pyridyl>-cumarin |