1,8-diazabicyclo[5.4.0]undec-7-ene, compound with 2-ethylhexanoic acid (1:1) structure
|
Common Name | 1,8-diazabicyclo[5.4.0]undec-7-ene, compound with 2-ethylhexanoic acid (1:1) | ||
|---|---|---|---|---|
| CAS Number | 33918-18-2 | Molecular Weight | 296.44800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H32N2O2 | Melting Point | 35-39ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1,8-diazabicyclo[5.4.0]undec-7-ene, compound with 2-ethylhexanoic acid (1:1) |
|---|
| Melting Point | 35-39ºC(lit.) |
|---|---|
| Molecular Formula | C17H32N2O2 |
| Molecular Weight | 296.44800 |
| Exact Mass | 296.24600 |
| PSA | 52.90000 |
| LogP | 3.32550 |
| InChIKey | CZGBZUGXSWLVRA-UHFFFAOYSA-N |
| SMILES | C1CCC2=NCCCN2CC1.CCCCC(CC)C(=O)O |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/38 |
| Safety Phrases | 26 |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |