2-(benzylamino)-3-(1H-imidazol-5-yl)propan-1-ol structure
|
Common Name | 2-(benzylamino)-3-(1H-imidazol-5-yl)propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 339207-77-1 | Molecular Weight | 231.29400 | |
| Density | 1.19g/cm3 | Boiling Point | 502.4ºC at 760 mmHg | |
| Molecular Formula | C13H17N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 257.6ºC | |
| Name | 2-(benzylamino)-3-(1H-imidazol-5-yl)propan-1-ol |
|---|
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 502.4ºC at 760 mmHg |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.29400 |
| Flash Point | 257.6ºC |
| Exact Mass | 231.13700 |
| PSA | 60.94000 |
| LogP | 1.49380 |
| Index of Refraction | 1.608 |
| InChIKey | ARSAGVGSZLEXHZ-UHFFFAOYSA-N |
| SMILES | OCC(Cc1cnc[nH]1)NCc1ccccc1 |
| HS Code | 2933290090 |
|---|
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |