Benzene,1-(dimethoxymethyl)-3-nitro- structure
|
Common Name | Benzene,1-(dimethoxymethyl)-3-nitro- | ||
|---|---|---|---|---|
| CAS Number | 3395-79-7 | Molecular Weight | 197.18800 | |
| Density | 1.201g/cm3 | Boiling Point | 244.6ºC at 760mmHg | |
| Molecular Formula | C9H11NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 96ºC | |
| Name | 1-(dimethoxymethyl)-3-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.201g/cm3 |
|---|---|
| Boiling Point | 244.6ºC at 760mmHg |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.18800 |
| Flash Point | 96ºC |
| Exact Mass | 197.06900 |
| PSA | 64.28000 |
| LogP | 2.40940 |
| Index of Refraction | 1.527 |
| InChIKey | ALXDDWGEZDTXOE-UHFFFAOYSA-N |
| SMILES | COC(OC)c1cccc([N+](=O)[O-])c1 |
| HS Code | 2909309090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| m-nitrobenzaldehyde dimethyl acetal |
| 1-(1,1-dimethoxymethyl)-3-nitrobenzene |
| dimethyl-3-nitrobenzacetal |
| 1-(m-nitrophenyl)-1,1-dimethoxymethane |
| 3-nitrobenzaldehyde dimethyl acetal |